C26H37IN3O5+ — CID 145467012
3-[[(2R,3R,4S,6R)-3-hydroxy-2-(iodomethyl)-6-methyloxan-4-yl]-methylamino]-N-[3-[4-(1-hydroxy-6-methylpyridin-1-ium-3-yl)phenoxy]propyl]propanamide (PubChem CID 145467012) has the molecular formula C26H37IN3O5+ and a molecular weight of 598.50 g/mol. Its IUPAC name is 3-[[(2R,3R,4S,6R)-3-hydroxy-2-(iodomethyl)-6-methyloxan-4-yl]-methylamino]-N-[3-[4-(1-hydroxy-6-methylpyridin-1-ium-3-yl)phenoxy]propyl]propanamide.
| Compound Name | 3-[[(2R,3R,4S,6R)-3-hydroxy-2-(iodomethyl)-6-methyloxan-4-yl]-methylamino]-N-[3-[4-(1-hydroxy-6-methylpyridin-1-ium-3-yl)phenoxy]propyl]propanamide |
|---|---|
| PubChem CID | 145467012 |
| Molecular Formula | C26H37IN3O5+ |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 3-[[(2R,3R,4S,6R)-3-hydroxy-2-(iodomethyl)-6-methyloxan-4-yl]-methylamino]-N-[3-[4-(1-hydroxy-6-methylpyridin-1-ium-3-yl)phenoxy]propyl]propanamide |
| SMILES | Cc1ccc(-c2ccc(OCCCNC(=O)CCN(C)[C@H]3C[C@@H](C)O[C@@H](CI)[C@@H]3O)cc2)c[n+]1O |
| InChI | InChI=1S/C26H36IN3O5/c1-18-5-6-21(17-30(18)33)20-7-9-22(10-8-20)34-14-4-12-28-25(31)11-13-29(3)23-15-19(2)35-24(16-27)26(23)32/h5-10,17,19,23-24,26,32H,4,11-16H2,1-3H3,(H-,28,31,33)/p+1/t19-,23+,24+,26-/m1/s1 |
| InChIKey | SAHGSIAMFPYSBW-POWYGARRSA-O |
| XLogP | 2.74 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|