C21H31N3O6 — CID 145467113
N-[3-[[(2R,3R,4S,6R)-2,3-dihydroxy-6-methyloxan-4-yl]-methylamino]propyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide (PubChem CID 145467113) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[3-[[(2R,3R,4S,6R)-2,3-dihydroxy-6-methyloxan-4-yl]-methylamino]propyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide.
| Compound Name | N-[3-[[(2R,3R,4S,6R)-2,3-dihydroxy-6-methyloxan-4-yl]-methylamino]propyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide |
|---|---|
| PubChem CID | 145467113 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-[3-[[(2R,3R,4S,6R)-2,3-dihydroxy-6-methyloxan-4-yl]-methylamino]propyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide |
| SMILES | C[C@@H]1C[C@H](N(C)CCCNC(=O)CCN2C(=O)COc3ccccc32)[C@@H](O)[C@H](O)O1 |
| InChI | InChI=1S/C21H31N3O6/c1-14-12-16(20(27)21(28)30-14)23(2)10-5-9-22-18(25)8-11-24-15-6-3-4-7-17(15)29-13-19(24)26/h3-4,6-7,14,16,20-21,27-28H,5,8-13H2,1-2H3,(H,22,25)/t14-,16+,20-,21-/m1/s1 |
| InChIKey | QGNCQYYNDRACBR-MGTBRSBRSA-N |
| XLogP | 0.10 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|