C5H9NOS — CID 145467203
4-methyl-2,3-dihydro-1,4-thiazine 1-oxide (PubChem CID 145467203) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1,4-thiazine 1-oxide.
| Compound Name | 4-methyl-2,3-dihydro-1,4-thiazine 1-oxide |
|---|---|
| PubChem CID | 145467203 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 4-methyl-2,3-dihydro-1,4-thiazine 1-oxide |
| SMILES | CN1C=CS(=O)CC1 |
| InChI | InChI=1S/C5H9NOS/c1-6-2-4-8(7)5-3-6/h2,4H,3,5H2,1H3 |
| InChIKey | FWRMXVJMAULDOK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |