C14H23NO3Sr — CID 145470366
strontium;tert-butyl (6Z)-6-ethylidene-7-methanidylidene-1,4-oxazepane-4-carboxylate;carbanide (PubChem CID 145470366) has the molecular formula C14H23NO3Sr and a molecular weight of 340.96 g/mol. Its IUPAC name is strontium;tert-butyl (6Z)-6-ethylidene-7-methanidylidene-1,4-oxazepane-4-carboxylate;carbanide.
| Compound Name | strontium;tert-butyl (6Z)-6-ethylidene-7-methanidylidene-1,4-oxazepane-4-carboxylate;carbanide |
|---|---|
| PubChem CID | 145470366 |
| Molecular Formula | C14H23NO3Sr |
| Molecular Weight | 340.96 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | strontium;tert-butyl (6Z)-6-ethylidene-7-methanidylidene-1,4-oxazepane-4-carboxylate;carbanide |
| SMILES | [CH3-].[H]/[C-]=C1/OCCN(C(=O)OC(C)(C)C)C/C1=C/C.[Sr+2] |
| InChI | InChI=1S/C13H20NO3.CH3.Sr/c1-6-11-9-14(7-8-16-10(11)2)12(15)17-13(3,4)5;;/h2,6H,7-9H2,1,3-5H3;1H3;/q2*-1;+2/b11-6-;; |
| InChIKey | CHTLJTSMNJQAQI-LEOXJOGCSA-N |
| XLogP | 2.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.96 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|