C24H39NO3 — CID 145472795
tert-butyl N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-[2-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxyethyl]carbamate;ethane (PubChem CID 145472795) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is tert-butyl N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-[2-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxyethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-[2-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxyethyl]carbamate;ethane |
|---|---|
| PubChem CID | 145472795 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | tert-butyl N-[(2E)-2-ethenylpenta-2,4-dienyl]-N-[2-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]oxyethyl]carbamate;ethane |
| SMILES | C=C/C=C(\C=C)CN(CCOC(/C=C(/C)C=C)=C/C)C(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C22H33NO3.C2H6/c1-9-13-19(11-3)17-23(21(24)26-22(6,7)8)14-15-25-20(12-4)16-18(5)10-2;1-2/h9-13,16H,1-3,14-15,17H2,4-8H3;1-2H3/b18-16-,19-13+,20-12+; |
| InChIKey | YZHAEGPQMGICRC-BWCIWRRSSA-N |
| XLogP | 6.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|