C23H39NO4 — CID 123756403
tert-butyl N-(3-ethylidene-5-methoxyhepta-4,6-dien-2-yl)-N-[2-(2-methylprop-2-enoxy)butyl]carbamate (PubChem CID 123756403) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is tert-butyl N-(3-ethylidene-5-methoxyhepta-4,6-dien-2-yl)-N-[2-(2-methylprop-2-enoxy)butyl]carbamate.
| Compound Name | tert-butyl N-(3-ethylidene-5-methoxyhepta-4,6-dien-2-yl)-N-[2-(2-methylprop-2-enoxy)butyl]carbamate |
|---|---|
| PubChem CID | 123756403 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | tert-butyl N-(3-ethylidene-5-methoxyhepta-4,6-dien-2-yl)-N-[2-(2-methylprop-2-enoxy)butyl]carbamate |
| SMILES | C=CC(=CC(=CC)C(C)N(CC(CC)OCC(=C)C)C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C23H39NO4/c1-11-19(14-20(12-2)26-10)18(6)24(22(25)28-23(7,8)9)15-21(13-3)27-16-17(4)5/h11-12,14,18,21H,2,4,13,15-16H2,1,3,5-10H3 |
| InChIKey | OPIGJMIIRQAZNJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|