C22H37NO3 — CID 143976852
tert-butyl 2-[[(2E,4Z)-5-ethenylnona-2,4,8-trien-3-yl]oxymethyl]azetidine-1-carboxylate;ethane (PubChem CID 143976852) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is tert-butyl 2-[[(2E,4Z)-5-ethenylnona-2,4,8-trien-3-yl]oxymethyl]azetidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 2-[[(2E,4Z)-5-ethenylnona-2,4,8-trien-3-yl]oxymethyl]azetidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143976852 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | tert-butyl 2-[[(2E,4Z)-5-ethenylnona-2,4,8-trien-3-yl]oxymethyl]azetidine-1-carboxylate;ethane |
| SMILES | C=CCC/C(C=C)=C/C(=C\C)OCC1CCN1C(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C20H31NO3.C2H6/c1-7-10-11-16(8-2)14-18(9-3)23-15-17-12-13-21(17)19(22)24-20(4,5)6;1-2/h7-9,14,17H,1-2,10-13,15H2,3-6H3;1-2H3/b16-14+,18-9+; |
| InChIKey | XKFSVKKPOTZFCK-OAMNZAHDSA-N |
| XLogP | 6.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|