C28H47NO4 — CID 143435312
tert-butyl 2-[[(3Z,5E)-5-[(Z,2E)-2-propylidenehept-4-enoxy]octa-3,5-dien-2-yl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 143435312) has the molecular formula C28H47NO4 and a molecular weight of 461.69 g/mol. Its IUPAC name is tert-butyl 2-[[(3Z,5E)-5-[(Z,2E)-2-propylidenehept-4-enoxy]octa-3,5-dien-2-yl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3Z,5E)-5-[(Z,2E)-2-propylidenehept-4-enoxy]octa-3,5-dien-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143435312 |
| Molecular Formula | C28H47NO4 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | tert-butyl 2-[[(3Z,5E)-5-[(Z,2E)-2-propylidenehept-4-enoxy]octa-3,5-dien-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC/C=C\C/C(=C\CC)COC(/C=C\C(C)OCC1CCCN1C(=O)OC(C)(C)C)=C/CC |
| InChI | InChI=1S/C28H47NO4/c1-8-11-12-16-24(14-9-2)21-32-26(15-10-3)19-18-23(4)31-22-25-17-13-20-29(25)27(30)33-28(5,6)7/h11-12,14-15,18-19,23,25H,8-10,13,16-17,20-22H2,1-7H3/b12-11-,19-18-,24-14+,26-15+ |
| InChIKey | CQBHMZSWOZEFDL-VCNYBDFWSA-N |
| XLogP | 7.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|