C24H43NO4 — CID 123141901
tert-butyl N-(3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl)-N-[2-(2-methylpropoxy)butyl]carbamate (PubChem CID 123141901) has the molecular formula C24H43NO4 and a molecular weight of 409.61 g/mol. Its IUPAC name is tert-butyl N-(3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl)-N-[2-(2-methylpropoxy)butyl]carbamate.
| Compound Name | tert-butyl N-(3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl)-N-[2-(2-methylpropoxy)butyl]carbamate |
|---|---|
| PubChem CID | 123141901 |
| Molecular Formula | C24H43NO4 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | tert-butyl N-(3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl)-N-[2-(2-methylpropoxy)butyl]carbamate |
| SMILES | C=C(C)C(=CC(=CC)C(C)N(CC(CC)OCC(C)C)C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C24H43NO4/c1-12-20(14-22(27-11)18(5)6)19(7)25(23(26)29-24(8,9)10)15-21(13-2)28-16-17(3)4/h12,14,17,19,21H,5,13,15-16H2,1-4,6-11H3 |
| InChIKey | FQFZMSJDVRDSOD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|