C22H40N2O3 — CID 169115091
tert-butyl N-[(3E,5E)-5-[2-(dimethylamino)ethoxy]-3-ethylhepta-1,3,5-trien-2-yl]-N-(2-methylpropyl)carbamate (PubChem CID 169115091) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is tert-butyl N-[(3E,5E)-5-[2-(dimethylamino)ethoxy]-3-ethylhepta-1,3,5-trien-2-yl]-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-[(3E,5E)-5-[2-(dimethylamino)ethoxy]-3-ethylhepta-1,3,5-trien-2-yl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 169115091 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | tert-butyl N-[(3E,5E)-5-[2-(dimethylamino)ethoxy]-3-ethylhepta-1,3,5-trien-2-yl]-N-(2-methylpropyl)carbamate |
| SMILES | C=C(/C(=C/C(=C\C)OCCN(C)C)CC)N(CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40N2O3/c1-11-19(15-20(12-2)26-14-13-23(9)10)18(5)24(16-17(3)4)21(25)27-22(6,7)8/h12,15,17H,5,11,13-14,16H2,1-4,6-10H3/b19-15+,20-12+ |
| InChIKey | XGXUYEVPIHMJMB-UYCURAHMSA-N |
| XLogP | 5.21 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|