C21H39N3O3 — CID 168888301
tert-butyl N-[2-[[(2E,4E)-6-amino-5-methoxy-7-methylnona-2,4,6-trien-3-yl]-ethylamino]ethyl]-N-methylcarbamate (PubChem CID 168888301) has the molecular formula C21H39N3O3 and a molecular weight of 381.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2E,4E)-6-amino-5-methoxy-7-methylnona-2,4,6-trien-3-yl]-ethylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(2E,4E)-6-amino-5-methoxy-7-methylnona-2,4,6-trien-3-yl]-ethylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168888301 |
| Molecular Formula | C21H39N3O3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | tert-butyl N-[2-[[(2E,4E)-6-amino-5-methoxy-7-methylnona-2,4,6-trien-3-yl]-ethylamino]ethyl]-N-methylcarbamate |
| SMILES | C/C=C(\C=C(\OC)C(N)=C(C)CC)N(CC)CCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39N3O3/c1-10-16(4)19(22)18(26-9)15-17(11-2)24(12-3)14-13-23(8)20(25)27-21(5,6)7/h11,15H,10,12-14,22H2,1-9H3/b17-11+,18-15+,19-16? |
| InChIKey | BHSSYLGHCCNYQQ-YGOBHFHGSA-N |
| XLogP | 4.25 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|