C21H33N3O3 — CID 171095002
tert-butyl 4-[(3Z,5Z,7Z)-6-cyano-5-methoxy-7-methylnona-3,5,7-trien-4-yl]piperazine-1-carboxylate (PubChem CID 171095002) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl 4-[(3Z,5Z,7Z)-6-cyano-5-methoxy-7-methylnona-3,5,7-trien-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3Z,5Z,7Z)-6-cyano-5-methoxy-7-methylnona-3,5,7-trien-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171095002 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | tert-butyl 4-[(3Z,5Z,7Z)-6-cyano-5-methoxy-7-methylnona-3,5,7-trien-4-yl]piperazine-1-carboxylate |
| SMILES | C/C=C(C)\C(C#N)=C(OC)/C(=C/CC)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H33N3O3/c1-8-10-18(19(26-7)17(15-22)16(3)9-2)23-11-13-24(14-12-23)20(25)27-21(4,5)6/h9-10H,8,11-14H2,1-7H3/b16-9-,18-10-,19-17+ |
| InChIKey | ZGXUFRDREPLXMC-QUEJDSISSA-N |
| XLogP | 4.22 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|