C26H42N4OS — CID 145471477
4-[2-(diethylamino)ethoxy]-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylaniline;ethane (PubChem CID 145471477) has the molecular formula C26H42N4OS and a molecular weight of 458.72 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethoxy]-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylaniline;ethane.
| Compound Name | 4-[2-(diethylamino)ethoxy]-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylaniline;ethane |
|---|---|
| PubChem CID | 145471477 |
| Molecular Formula | C26H42N4OS |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | 4-[2-(diethylamino)ethoxy]-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylaniline;ethane |
| SMILES | CC.CCN(CC)CCOc1ccc(NSc2cccc(CN3CCN(C)CC3)c2)cc1 |
| InChI | InChI=1S/C24H36N4OS.C2H6/c1-4-27(5-2)17-18-29-23-11-9-22(10-12-23)25-30-24-8-6-7-21(19-24)20-28-15-13-26(3)14-16-28;1-2/h6-12,19,25H,4-5,13-18,20H2,1-3H3;1-2H3 |
| InChIKey | YOTOKVGQMVCIDZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|