C30H43N3OS — CID 145471537
2-[4-[[[3-[(benzylamino)methyl]phenyl]sulfanyl-methylamino]methyl]phenoxy]-N,N-diethylethanamine;ethane (PubChem CID 145471537) has the molecular formula C30H43N3OS and a molecular weight of 493.76 g/mol. Its IUPAC name is 2-[4-[[[3-[(benzylamino)methyl]phenyl]sulfanyl-methylamino]methyl]phenoxy]-N,N-diethylethanamine;ethane.
| Compound Name | 2-[4-[[[3-[(benzylamino)methyl]phenyl]sulfanyl-methylamino]methyl]phenoxy]-N,N-diethylethanamine;ethane |
|---|---|
| PubChem CID | 145471537 |
| Molecular Formula | C30H43N3OS |
| Molecular Weight | 493.76 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | 2-[4-[[[3-[(benzylamino)methyl]phenyl]sulfanyl-methylamino]methyl]phenoxy]-N,N-diethylethanamine;ethane |
| SMILES | CC.CCN(CC)CCOc1ccc(CN(C)Sc2cccc(CNCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H37N3OS.C2H6/c1-4-31(5-2)18-19-32-27-16-14-25(15-17-27)23-30(3)33-28-13-9-12-26(20-28)22-29-21-24-10-7-6-8-11-24;1-2/h6-17,20,29H,4-5,18-19,21-23H2,1-3H3;1-2H3 |
| InChIKey | IYXDBMOHMHSGOA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|