C11H13N3S — CID 145471608
3-[(1H-imidazol-2-ylmethylamino)methyl]benzenethiol (PubChem CID 145471608) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-[(1H-imidazol-2-ylmethylamino)methyl]benzenethiol.
| Compound Name | 3-[(1H-imidazol-2-ylmethylamino)methyl]benzenethiol |
|---|---|
| PubChem CID | 145471608 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-[(1H-imidazol-2-ylmethylamino)methyl]benzenethiol |
| SMILES | Sc1cccc(CNCc2ncc[nH]2)c1 |
| InChI | InChI=1S/C11H13N3S/c15-10-3-1-2-9(6-10)7-12-8-11-13-4-5-14-11/h1-6,12,15H,7-8H2,(H,13,14) |
| InChIKey | NDHFATUBLSHFDP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|