C11H13N3O2 — CID 64548372
3-[(1H-imidazol-2-ylmethylamino)methyl]benzene-1,2-diol (PubChem CID 64548372) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-[(1H-imidazol-2-ylmethylamino)methyl]benzene-1,2-diol.
| Compound Name | 3-[(1H-imidazol-2-ylmethylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 64548372 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-[(1H-imidazol-2-ylmethylamino)methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CNCc2ncc[nH]2)c1O |
| InChI | InChI=1S/C11H13N3O2/c15-9-3-1-2-8(11(9)16)6-12-7-10-13-4-5-14-10/h1-5,12,15-16H,6-7H2,(H,13,14) |
| InChIKey | CVJLXHYPNGLWTB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|