C14H16N2O2 — CID 63305798
3-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzene-1,2-diol (PubChem CID 63305798) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 63305798 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzene-1,2-diol |
| SMILES | Cc1cccnc1CNCc1cccc(O)c1O |
| InChI | InChI=1S/C14H16N2O2/c1-10-4-3-7-16-12(10)9-15-8-11-5-2-6-13(17)14(11)18/h2-7,15,17-18H,8-9H2,1H3 |
| InChIKey | FOKQIDQYBQKLIK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|