C10H12N2 — CID 145471810
1,5-bis(ethenyl)-N-methylpyridin-2-imine (PubChem CID 145471810) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,5-bis(ethenyl)-N-methylpyridin-2-imine.
| Compound Name | 1,5-bis(ethenyl)-N-methylpyridin-2-imine |
|---|---|
| PubChem CID | 145471810 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,5-bis(ethenyl)-N-methylpyridin-2-imine |
| SMILES | C=Cc1cc/c(=N\C)n(C=C)c1 |
| InChI | InChI=1S/C10H12N2/c1-4-9-6-7-10(11-3)12(5-2)8-9/h4-8H,1-2H2,3H3/b11-10+ |
| InChIKey | BHTMNCNHTYSFPO-ZHACJKMWSA-N |
| XLogP | 1.76 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |