C22H38N3O2S+ — CID 145473437
(4-methoxy-4-oxobutyl)-trimethylazanium;S-(4-oct-1-ynylanilino)thiohydroxylamine (PubChem CID 145473437) has the molecular formula C22H38N3O2S+ and a molecular weight of 408.63 g/mol. Its IUPAC name is (4-methoxy-4-oxobutyl)-trimethylazanium;S-(4-oct-1-ynylanilino)thiohydroxylamine.
| Compound Name | (4-methoxy-4-oxobutyl)-trimethylazanium;S-(4-oct-1-ynylanilino)thiohydroxylamine |
|---|---|
| PubChem CID | 145473437 |
| Molecular Formula | C22H38N3O2S+ |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (4-methoxy-4-oxobutyl)-trimethylazanium;S-(4-oct-1-ynylanilino)thiohydroxylamine |
| SMILES | CCCCCCC#Cc1ccc(NSN)cc1.COC(=O)CCC[N+](C)(C)C |
| InChI | InChI=1S/C14H20N2S.C8H18NO2/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)16-17-15;1-9(2,3)7-5-6-8(10)11-4/h9-12,16H,2-6,15H2,1H3;5-7H2,1-4H3/q;+1 |
| InChIKey | ZDOOPCNMYFHCFM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|