C19H23N2O5+ — CID 145473516
2-[1,1-dimethyl-2-[5-[(3-methylphenoxy)methyl]furan-2-carbonyl]diazetidin-1-ium-3-yl]acetic acid (PubChem CID 145473516) has the molecular formula C19H23N2O5+ and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-[1,1-dimethyl-2-[5-[(3-methylphenoxy)methyl]furan-2-carbonyl]diazetidin-1-ium-3-yl]acetic acid.
| Compound Name | 2-[1,1-dimethyl-2-[5-[(3-methylphenoxy)methyl]furan-2-carbonyl]diazetidin-1-ium-3-yl]acetic acid |
|---|---|
| PubChem CID | 145473516 |
| Molecular Formula | C19H23N2O5+ |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-[1,1-dimethyl-2-[5-[(3-methylphenoxy)methyl]furan-2-carbonyl]diazetidin-1-ium-3-yl]acetic acid |
| SMILES | Cc1cccc(OCc2ccc(C(=O)N3C(CC(=O)O)C[N+]3(C)C)o2)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-13-5-4-6-15(9-13)25-12-16-7-8-17(26-16)19(24)20-14(10-18(22)23)11-21(20,2)3/h4-9,14H,10-12H2,1-3H3/p+1 |
| InChIKey | GEQADYJLKRWQPB-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|