C18H22N3O4+ — CID 145473524
[(2R)-3-carboxy-2-[[methyl-(4-phenoxyphenyl)carbamoyl]amino]propyl]azanium (PubChem CID 145473524) has the molecular formula C18H22N3O4+ and a molecular weight of 344.39 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[[methyl-(4-phenoxyphenyl)carbamoyl]amino]propyl]azanium.
| Compound Name | [(2R)-3-carboxy-2-[[methyl-(4-phenoxyphenyl)carbamoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 145473524 |
| Molecular Formula | C18H22N3O4+ |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(2R)-3-carboxy-2-[[methyl-(4-phenoxyphenyl)carbamoyl]amino]propyl]azanium |
| SMILES | CN(C(=O)N[C@@H](C[NH3+])CC(=O)O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-21(18(24)20-13(12-19)11-17(22)23)14-7-9-16(10-8-14)25-15-5-3-2-4-6-15/h2-10,13H,11-12,19H2,1H3,(H,20,24)(H,22,23)/p+1/t13-/m1/s1 |
| InChIKey | CNTGGNZCARHROL-CYBMUJFWSA-O |
| XLogP | 1.71 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |