About ethane;iodomethane;4-propan-2-ylbenzaldehyde
ethane;iodomethane;4-propan-2-ylbenzaldehyde (PubChem CID 145474217) has the molecular formula C13H21IO
and a molecular weight of 320.21 g/mol. Its IUPAC name is ethane;iodomethane;4-propan-2-ylbenzaldehyde.
Molecular Properties
| Compound Name | ethane;iodomethane;4-propan-2-ylbenzaldehyde |
| PubChem CID | 145474217 |
| Molecular Formula | C13H21IO |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | ethane;iodomethane;4-propan-2-ylbenzaldehyde |
| SMILES | CC.CC(C)c1ccc(C=O)cc1.CI |
| InChI | InChI=1S/C10H12O.C2H6.CH3I/c1-8(2)10-5-3-9(7-11)4-6-10;2*1-2/h3-8H,1-2H3;1-2H3;1H3 |
| InChIKey | NNFSJZRJMWKWMI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;iodomethane;4-propan-2-ylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;iodomethane;4-propan-2-ylbenzaldehyde?
The IUPAC name of ethane;iodomethane;4-propan-2-ylbenzaldehyde (CID 145474217) is ethane;iodomethane;4-propan-2-ylbenzaldehyde.
What is the SMILES notation for ethane;iodomethane;4-propan-2-ylbenzaldehyde?
The canonical SMILES for ethane;iodomethane;4-propan-2-ylbenzaldehyde is CC.CC(C)c1ccc(C=O)cc1.CI.
What is the InChIKey of ethane;iodomethane;4-propan-2-ylbenzaldehyde?
The InChIKey is NNFSJZRJMWKWMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C2H6.CH3I/c1-8(2)10-5-3-9(7-11)4-6-10;2*1-2/h3-8H,1-2H3;1-2H3;1H3.
What are the key properties of ethane;iodomethane;4-propan-2-ylbenzaldehyde?
ethane;iodomethane;4-propan-2-ylbenzaldehyde has a molecular weight of 320.21 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;iodomethane;4-propan-2-ylbenzaldehyde is sourced from PubChem (CID 145474217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).