C9H8Br2O — CID 86030216
4-(1,2-dibromoethyl)benzaldehyde (PubChem CID 86030216) has the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. Its IUPAC name is 4-(1,2-dibromoethyl)benzaldehyde.
| Compound Name | 4-(1,2-dibromoethyl)benzaldehyde |
|---|---|
| PubChem CID | 86030216 |
| Molecular Formula | C9H8Br2O |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | 4-(1,2-dibromoethyl)benzaldehyde |
| SMILES | O=Cc1ccc(C(Br)CBr)cc1 |
| InChI | InChI=1S/C9H8Br2O/c10-5-9(11)8-3-1-7(6-12)2-4-8/h1-4,6,9H,5H2 |
| InChIKey | ZDKUMVBJKYGGMS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|