About 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea
1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea (PubChem CID 145475085) has the molecular formula C22H39N3O2
and a molecular weight of 377.57 g/mol. Its IUPAC name is 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea.
Molecular Properties
| Compound Name | 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea |
| PubChem CID | 145475085 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea |
| SMILES | CCC1(NC(=O)NC2CCN(C(=O)C(C)(C)C)CC2)CC2CCCC(C2)C1 |
| InChI | InChI=1S/C22H39N3O2/c1-5-22(14-16-7-6-8-17(13-16)15-22)24-20(27)23-18-9-11-25(12-10-18)19(26)21(2,3)4/h16-18H,5-15H2,1-4H3,(H2,23,24,27) |
| InChIKey | VRSGKFPPTOQNGA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea?
The IUPAC name of 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea (CID 145475085) is 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea.
What is the SMILES notation for 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea?
The canonical SMILES for 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea is CCC1(NC(=O)NC2CCN(C(=O)C(C)(C)C)CC2)CC2CCCC(C2)C1.
What is the InChIKey of 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea?
The InChIKey is VRSGKFPPTOQNGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39N3O2/c1-5-22(14-16-7-6-8-17(13-16)15-22)24-20(27)23-18-9-11-25(12-10-18)19(26)21(2,3)4/h16-18H,5-15H2,1-4H3,(H2,23,24,27).
What are the key properties of 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea?
1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea has a molecular weight of 377.57 g/mol, XLogP of 4.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-3-(3-ethyl-3-bicyclo[3.3.1]nonanyl)urea is sourced from PubChem (CID 145475085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).