C29H29F3N6O4 — CID 145475239
ethane;2-[9-ethenyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.4]non-8-en-1-yl]-N-(2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[c]pyridine]-3'-yl)acetamide (PubChem CID 145475239) has the molecular formula C29H29F3N6O4 and a molecular weight of 582.58 g/mol. Its IUPAC name is ethane;2-[9-ethenyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.4]non-8-en-1-yl]-N-(2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[c]pyridine]-3'-yl)acetamide.
| Compound Name | ethane;2-[9-ethenyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.4]non-8-en-1-yl]-N-(2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[c]pyridine]-3'-yl)acetamide |
|---|---|
| PubChem CID | 145475239 |
| Molecular Formula | C29H29F3N6O4 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | ethane;2-[9-ethenyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.4]non-8-en-1-yl]-N-(2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[c]pyridine]-3'-yl)acetamide |
| SMILES | C=CC1=CCCC12C(=O)N(CC(F)(F)F)C(=O)N2CC(=O)Nc1cc2c(cn1)CC1(C2)C(=O)Nc2ncccc21.CC |
| InChI | InChI=1S/C27H23F3N6O4.C2H6/c1-2-17-5-3-7-26(17)23(39)35(14-27(28,29)30)24(40)36(26)13-20(37)33-19-9-15-10-25(11-16(15)12-32-19)18-6-4-8-31-21(18)34-22(25)38;1-2/h2,4-6,8-9,12H,1,3,7,10-11,13-14H2,(H,31,34,38)(H,32,33,37);1-2H3 |
| InChIKey | VOJNGCSASWXCKS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|