C28H28F3N5O4 — CID 25173078
2-[2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.6]undecan-1-yl]-N-[(2R)-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl]acetamide (PubChem CID 25173078) has the molecular formula C28H28F3N5O4 and a molecular weight of 555.56 g/mol. Its IUPAC name is 2-[2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.6]undecan-1-yl]-N-[(2R)-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl]acetamide.
| Compound Name | 2-[2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.6]undecan-1-yl]-N-[(2R)-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl]acetamide |
|---|---|
| PubChem CID | 25173078 |
| Molecular Formula | C28H28F3N5O4 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 2-[2,4-dioxo-3-(2,2,2-trifluoroethyl)-1,3-diazaspiro[4.6]undecan-1-yl]-N-[(2R)-2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl]acetamide |
| SMILES | O=C(CN1C(=O)N(CC(F)(F)F)C(=O)C12CCCCCC2)Nc1ccc2c(c1)C[C@@]1(C2)C(=O)Nc2ncccc21 |
| InChI | InChI=1S/C28H28F3N5O4/c29-28(30,31)16-35-24(39)27(9-3-1-2-4-10-27)36(25(35)40)15-21(37)33-19-8-7-17-13-26(14-18(17)12-19)20-6-5-11-32-22(20)34-23(26)38/h5-8,11-12H,1-4,9-10,13-16H2,(H,33,37)(H,32,34,38)/t26-/m1/s1 |
| InChIKey | GXZWQDJPAPQUDQ-AREMUKBSSA-N |
| XLogP | 3.93 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|