C25H25ClN2O2 — CID 145475852
7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-5-(4-hydroxyphenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (PubChem CID 145475852) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-5-(4-hydroxyphenyl)-1-methyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-5-(4-hydroxyphenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 145475852 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-5-(4-hydroxyphenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| SMILES | C=C/C(=C\C=C/C)CCC1N=C(c2ccc(O)cc2)c2cc(Cl)ccc2N(C)C1=O |
| InChI | InChI=1S/C25H25ClN2O2/c1-4-6-7-17(5-2)8-14-22-25(30)28(3)23-15-11-19(26)16-21(23)24(27-22)18-9-12-20(29)13-10-18/h4-7,9-13,15-16,22,29H,2,8,14H2,1,3H3/b6-4-,17-7+ |
| InChIKey | VLRPKYUEMSGIEX-KFKUOEFMSA-N |
| XLogP | 5.70 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|