C31H39ClN4O2 — CID 145475845
1-tert-butyl-3-[4-[7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl]phenyl]urea;ethane (PubChem CID 145475845) has the molecular formula C31H39ClN4O2 and a molecular weight of 535.13 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-[7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl]phenyl]urea;ethane.
| Compound Name | 1-tert-butyl-3-[4-[7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl]phenyl]urea;ethane |
|---|---|
| PubChem CID | 145475845 |
| Molecular Formula | C31H39ClN4O2 |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 1-tert-butyl-3-[4-[7-chloro-3-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl]phenyl]urea;ethane |
| SMILES | C=C/C(=C\C=C/C)CCC1N=C(c2ccc(NC(=O)NC(C)(C)C)cc2)c2cc(Cl)ccc2NC1=O.CC |
| InChI | InChI=1S/C29H33ClN4O2.C2H6/c1-6-8-9-19(7-2)10-16-25-27(35)33-24-17-13-21(30)18-23(24)26(32-25)20-11-14-22(15-12-20)31-28(36)34-29(3,4)5;1-2/h6-9,11-15,17-18,25H,2,10,16H2,1,3-5H3,(H,33,35)(H2,31,34,36);1-2H3/b8-6-,19-9+; |
| InChIKey | QQUWQIFFDWHPHG-SDRGSBSKSA-N |
| XLogP | 7.91 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|