About (4-methoxyphenoxy) hypoiodite
(4-methoxyphenoxy) hypoiodite (PubChem CID 145476499) has the molecular formula C7H7IO3
and a molecular weight of 266.03 g/mol. Its IUPAC name is (4-methoxyphenoxy) hypoiodite.
Molecular Properties
| Compound Name | (4-methoxyphenoxy) hypoiodite |
| PubChem CID | 145476499 |
| Molecular Formula | C7H7IO3 |
| Molecular Weight | 266.03 g/mol |
| Exact Mass | 265.94 |
| IUPAC Name | (4-methoxyphenoxy) hypoiodite |
| SMILES | COc1ccc(OOI)cc1 |
| InChI | InChI=1S/C7H7IO3/c1-9-6-2-4-7(5-3-6)10-11-8/h2-5H,1H3 |
| InChIKey | WTVBIYZBVUSXFP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.03 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenoxy) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenoxy) hypoiodite?
The IUPAC name of (4-methoxyphenoxy) hypoiodite (CID 145476499) is (4-methoxyphenoxy) hypoiodite.
What is the SMILES notation for (4-methoxyphenoxy) hypoiodite?
The canonical SMILES for (4-methoxyphenoxy) hypoiodite is COc1ccc(OOI)cc1.
What is the InChIKey of (4-methoxyphenoxy) hypoiodite?
The InChIKey is WTVBIYZBVUSXFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IO3/c1-9-6-2-4-7(5-3-6)10-11-8/h2-5H,1H3.
What are the key properties of (4-methoxyphenoxy) hypoiodite?
(4-methoxyphenoxy) hypoiodite has a molecular weight of 266.03 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenoxy) hypoiodite is sourced from PubChem (CID 145476499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).