About 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol
1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol (PubChem CID 144731544) has the molecular formula C14H16O6
and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol.
Molecular Properties
| Compound Name | 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol |
| PubChem CID | 144731544 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol |
| SMILES | CO.COc1ccc(OOc2ccc(OO)cc2)cc1 |
| InChI | InChI=1S/C13H12O5.CH4O/c1-15-10-2-6-12(7-3-10)17-18-13-8-4-11(16-14)5-9-13;1-2/h2-9,14H,1H3;2H,1H3 |
| InChIKey | QKPJTNQYZJGDNL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol?
The IUPAC name of 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol (CID 144731544) is 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol.
What is the SMILES notation for 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol?
The canonical SMILES for 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol is CO.COc1ccc(OOc2ccc(OO)cc2)cc1.
What is the InChIKey of 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol?
The InChIKey is QKPJTNQYZJGDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5.CH4O/c1-15-10-2-6-12(7-3-10)17-18-13-8-4-11(16-14)5-9-13;1-2/h2-9,14H,1H3;2H,1H3.
What are the key properties of 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol?
1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol has a molecular weight of 280.28 g/mol, XLogP of 2.53, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroperoxy-4-(4-methoxyphenyl)peroxybenzene;methanol is sourced from PubChem (CID 144731544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).