methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide

C13H17N3O3 — CID 145476787

IUPACmethyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide
SMILESCON=O.Cc1ccc2c(C(=O)N(C)C)c[nH]c2c1
InChIInChI=1S/C12H14N2O.CH3NO2/c1-8-4-5-9-10(12(15)14(2)3)7-13-11(9)6-8;1-4-2-3/h4-7,13H,1-3H3;1H3
InChIKeySQZQPQPFXNXATN-UHFFFAOYSA-N
MW263.30 g/mol
LogP2.49
Rot. Bonds2

About methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide

methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide (PubChem CID 145476787) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide.

Molecular Properties

Compound Namemethyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide
PubChem CID145476787
Molecular FormulaC13H17N3O3
Molecular Weight263.30 g/mol
Exact Mass263.13
IUPAC Namemethyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide
SMILESCON=O.Cc1ccc2c(C(=O)N(C)C)c[nH]c2c1
InChIInChI=1S/C12H14N2O.CH3NO2/c1-8-4-5-9-10(12(15)14(2)3)7-13-11(9)6-8;1-4-2-3/h4-7,13H,1-3H3;1H3
InChIKeySQZQPQPFXNXATN-UHFFFAOYSA-N
XLogP2.49
TPSA74.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.30
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide?
The IUPAC name of methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide (CID 145476787) is methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide.
What is the SMILES notation for methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide?
The canonical SMILES for methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide is CON=O.Cc1ccc2c(C(=O)N(C)C)c[nH]c2c1.
What is the InChIKey of methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide?
The InChIKey is SQZQPQPFXNXATN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O.CH3NO2/c1-8-4-5-9-10(12(15)14(2)3)7-13-11(9)6-8;1-4-2-3/h4-7,13H,1-3H3;1H3.
What are the key properties of methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide?
methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide has a molecular weight of 263.30 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl nitrite;N,N,6-trimethyl-1H-indole-3-carboxamide is sourced from PubChem (CID 145476787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).