C22H18F3N4O3S- — CID 145477978
2-[[2-[4-(2-oxopyrrolidin-1-yl)anilino]-5-(trifluoromethyl)-4-pyridinyl]amino]benzenesulfinate (PubChem CID 145477978) has the molecular formula C22H18F3N4O3S- and a molecular weight of 475.47 g/mol. Its IUPAC name is 2-[[2-[4-(2-oxopyrrolidin-1-yl)anilino]-5-(trifluoromethyl)-4-pyridinyl]amino]benzenesulfinate.
| Compound Name | 2-[[2-[4-(2-oxopyrrolidin-1-yl)anilino]-5-(trifluoromethyl)-4-pyridinyl]amino]benzenesulfinate |
|---|---|
| PubChem CID | 145477978 |
| Molecular Formula | C22H18F3N4O3S- |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2-[[2-[4-(2-oxopyrrolidin-1-yl)anilino]-5-(trifluoromethyl)-4-pyridinyl]amino]benzenesulfinate |
| SMILES | O=C1CCCN1c1ccc(Nc2cc(Nc3ccccc3S(=O)[O-])c(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C22H19F3N4O3S/c23-22(24,25)16-13-26-20(12-18(16)28-17-4-1-2-5-19(17)33(31)32)27-14-7-9-15(10-8-14)29-11-3-6-21(29)30/h1-2,4-5,7-10,12-13H,3,6,11H2,(H,31,32)(H2,26,27,28)/p-1 |
| InChIKey | GJTLJALJLPMIAK-UHFFFAOYSA-M |
| XLogP | 4.95 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|