C20H28FN4O2+ — CID 145478405
[(Z)-3-cyclopentyloxy-4-(5-fluoro-2-methylanilino)-4-oxo-2-piperazin-1-ylbut-2-enylidene]azanium (PubChem CID 145478405) has the molecular formula C20H28FN4O2+ and a molecular weight of 375.47 g/mol. Its IUPAC name is [(Z)-3-cyclopentyloxy-4-(5-fluoro-2-methylanilino)-4-oxo-2-piperazin-1-ylbut-2-enylidene]azanium.
| Compound Name | [(Z)-3-cyclopentyloxy-4-(5-fluoro-2-methylanilino)-4-oxo-2-piperazin-1-ylbut-2-enylidene]azanium |
|---|---|
| PubChem CID | 145478405 |
| Molecular Formula | C20H28FN4O2+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [(Z)-3-cyclopentyloxy-4-(5-fluoro-2-methylanilino)-4-oxo-2-piperazin-1-ylbut-2-enylidene]azanium |
| SMILES | Cc1ccc(F)cc1NC(=O)/C(OC1CCCC1)=C(\C=[NH2+])N1CCNCC1 |
| InChI | InChI=1S/C20H27FN4O2/c1-14-6-7-15(21)12-17(14)24-20(26)19(27-16-4-2-3-5-16)18(13-22)25-10-8-23-9-11-25/h6-7,12-13,16,22-23H,2-5,8-11H2,1H3,(H,24,26)/p+1/b19-18-,22-13? |
| InChIKey | HWTDNKLQVDVXMN-BOYUIBFASA-O |
| XLogP | 0.98 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|