C20H29FN4O2+2 — CID 145478184
[(Z)-3-cyclopentyloxy-4-(3-fluoro-5-methylanilino)-4-oxo-2-piperazin-4-ium-1-ylbut-2-enylidene]azanium (PubChem CID 145478184) has the molecular formula C20H29FN4O2+2 and a molecular weight of 376.48 g/mol. Its IUPAC name is [(Z)-3-cyclopentyloxy-4-(3-fluoro-5-methylanilino)-4-oxo-2-piperazin-4-ium-1-ylbut-2-enylidene]azanium.
| Compound Name | [(Z)-3-cyclopentyloxy-4-(3-fluoro-5-methylanilino)-4-oxo-2-piperazin-4-ium-1-ylbut-2-enylidene]azanium |
|---|---|
| PubChem CID | 145478184 |
| Molecular Formula | C20H29FN4O2+2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(Z)-3-cyclopentyloxy-4-(3-fluoro-5-methylanilino)-4-oxo-2-piperazin-4-ium-1-ylbut-2-enylidene]azanium |
| SMILES | Cc1cc(F)cc(NC(=O)/C(OC2CCCC2)=C(\C=[NH2+])N2CC[NH2+]CC2)c1 |
| InChI | InChI=1S/C20H27FN4O2/c1-14-10-15(21)12-16(11-14)24-20(26)19(27-17-4-2-3-5-17)18(13-22)25-8-6-23-7-9-25/h10-13,17,22-23H,2-9H2,1H3,(H,24,26)/p+2/b19-18-,22-13? |
| InChIKey | GONIUHSMNJQNTI-BOYUIBFASA-P |
| XLogP | -0.05 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|