C21H32F2N4O2 — CID 145478242
(Z)-3-[3-aminopropyl(methyl)amino]-2-cyclopentyloxy-N-(3,5-difluorophenyl)-4-iminobut-2-enamide;ethane (PubChem CID 145478242) has the molecular formula C21H32F2N4O2 and a molecular weight of 410.51 g/mol. Its IUPAC name is (Z)-3-[3-aminopropyl(methyl)amino]-2-cyclopentyloxy-N-(3,5-difluorophenyl)-4-iminobut-2-enamide;ethane.
| Compound Name | (Z)-3-[3-aminopropyl(methyl)amino]-2-cyclopentyloxy-N-(3,5-difluorophenyl)-4-iminobut-2-enamide;ethane |
|---|---|
| PubChem CID | 145478242 |
| Molecular Formula | C21H32F2N4O2 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (Z)-3-[3-aminopropyl(methyl)amino]-2-cyclopentyloxy-N-(3,5-difluorophenyl)-4-iminobut-2-enamide;ethane |
| SMILES | CC.[H]/N=C/C(=C(/OC1CCCC1)C(=O)Nc1cc(F)cc(F)c1)N(C)CCCN |
| InChI | InChI=1S/C19H26F2N4O2.C2H6/c1-25(8-4-7-22)17(12-23)18(27-16-5-2-3-6-16)19(26)24-15-10-13(20)9-14(21)11-15;1-2/h9-12,16,23H,2-8,22H2,1H3,(H,24,26);1-2H3/b18-17-,23-12+; |
| InChIKey | XKRLXSICQNSCBZ-NRKHWFJGSA-N |
| XLogP | 4.03 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|