C23H34ClN5O4S — CID 70692481
(Z)-N-(3-chlorophenyl)-2-cyclopentyloxy-3-[4-(diethylsulfamoyl)piperazin-1-yl]-4-iminobut-2-enamide (PubChem CID 70692481) has the molecular formula C23H34ClN5O4S and a molecular weight of 512.08 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-2-cyclopentyloxy-3-[4-(diethylsulfamoyl)piperazin-1-yl]-4-iminobut-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-2-cyclopentyloxy-3-[4-(diethylsulfamoyl)piperazin-1-yl]-4-iminobut-2-enamide |
|---|---|
| PubChem CID | 70692481 |
| Molecular Formula | C23H34ClN5O4S |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-2-cyclopentyloxy-3-[4-(diethylsulfamoyl)piperazin-1-yl]-4-iminobut-2-enamide |
| SMILES | [H]/N=C/C(=C(/OC1CCCC1)C(=O)Nc1cccc(Cl)c1)N1CCN(S(=O)(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C23H34ClN5O4S/c1-3-28(4-2)34(31,32)29-14-12-27(13-15-29)21(17-25)22(33-20-10-5-6-11-20)23(30)26-19-9-7-8-18(24)16-19/h7-9,16-17,20,25H,3-6,10-15H2,1-2H3,(H,26,30)/b22-21-,25-17+ |
| InChIKey | MKKUOZCKZQDJEY-NZXFJCBRSA-N |
| XLogP | 3.30 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|