C23H34FN4O5S+ — CID 145478407
(Z)-N-(3-fluorophenyl)-2-(3-hydroxy-3-methylcyclopentyl)oxy-4-imino-3-(4-propan-2-ylsulfonylpiperazin-4-ium-1-yl)but-2-enamide (PubChem CID 145478407) has the molecular formula C23H34FN4O5S+ and a molecular weight of 497.61 g/mol. Its IUPAC name is (Z)-N-(3-fluorophenyl)-2-(3-hydroxy-3-methylcyclopentyl)oxy-4-imino-3-(4-propan-2-ylsulfonylpiperazin-4-ium-1-yl)but-2-enamide.
| Compound Name | (Z)-N-(3-fluorophenyl)-2-(3-hydroxy-3-methylcyclopentyl)oxy-4-imino-3-(4-propan-2-ylsulfonylpiperazin-4-ium-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 145478407 |
| Molecular Formula | C23H34FN4O5S+ |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (Z)-N-(3-fluorophenyl)-2-(3-hydroxy-3-methylcyclopentyl)oxy-4-imino-3-(4-propan-2-ylsulfonylpiperazin-4-ium-1-yl)but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OC1CCC(C)(O)C1)C(=O)Nc1cccc(F)c1)N1CC[NH+](S(=O)(=O)C(C)C)CC1 |
| InChI | InChI=1S/C23H33FN4O5S/c1-16(2)34(31,32)28-11-9-27(10-12-28)20(15-25)21(33-19-7-8-23(3,30)14-19)22(29)26-18-6-4-5-17(24)13-18/h4-6,13,15-16,19,25,30H,7-12,14H2,1-3H3,(H,26,29)/p+1/b21-20-,25-15+ |
| InChIKey | GDSSEXUFQGAIFV-QKALCNHZSA-O |
| XLogP | 0.88 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|