C21H29ClF2N4O6S2 — CID 88858002
[1-[(Z)-3-chloro-4-(3,5-difluoroanilino)-1-imino-4-oxobut-2-en-2-yl]-4-propan-2-ylsulfonylpiperazin-2-yl]methyl propane-2-sulfonate (PubChem CID 88858002) has the molecular formula C21H29ClF2N4O6S2 and a molecular weight of 571.07 g/mol. Its IUPAC name is [1-[(Z)-3-chloro-4-(3,5-difluoroanilino)-1-imino-4-oxobut-2-en-2-yl]-4-propan-2-ylsulfonylpiperazin-2-yl]methyl propane-2-sulfonate.
| Compound Name | [1-[(Z)-3-chloro-4-(3,5-difluoroanilino)-1-imino-4-oxobut-2-en-2-yl]-4-propan-2-ylsulfonylpiperazin-2-yl]methyl propane-2-sulfonate |
|---|---|
| PubChem CID | 88858002 |
| Molecular Formula | C21H29ClF2N4O6S2 |
| Molecular Weight | 571.07 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | [1-[(Z)-3-chloro-4-(3,5-difluoroanilino)-1-imino-4-oxobut-2-en-2-yl]-4-propan-2-ylsulfonylpiperazin-2-yl]methyl propane-2-sulfonate |
| SMILES | [H]/N=C/C(=C(/Cl)C(=O)Nc1cc(F)cc(F)c1)N1CCN(S(=O)(=O)C(C)C)CC1COS(=O)(=O)C(C)C |
| InChI | InChI=1S/C21H29ClF2N4O6S2/c1-13(2)35(30,31)27-5-6-28(18(11-27)12-34-36(32,33)14(3)4)19(10-25)20(22)21(29)26-17-8-15(23)7-16(24)9-17/h7-10,13-14,18,25H,5-6,11-12H2,1-4H3,(H,26,29)/b20-19-,25-10+ |
| InChIKey | ZENZFKRENVCAPL-PCCFXDHVSA-N |
| XLogP | 2.48 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.07 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|