C18H19ClF2N6O4S — CID 123487427
2-chloro-N-(3,5-difluorophenyl)-4-imino-3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]piperazin-1-yl]but-2-enamide (PubChem CID 123487427) has the molecular formula C18H19ClF2N6O4S and a molecular weight of 488.90 g/mol. Its IUPAC name is 2-chloro-N-(3,5-difluorophenyl)-4-imino-3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]piperazin-1-yl]but-2-enamide.
| Compound Name | 2-chloro-N-(3,5-difluorophenyl)-4-imino-3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]piperazin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 123487427 |
| Molecular Formula | C18H19ClF2N6O4S |
| Molecular Weight | 488.90 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 2-chloro-N-(3,5-difluorophenyl)-4-imino-3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfonyl]piperazin-1-yl]but-2-enamide |
| SMILES | [H]/N=C/C(=C(Cl)C(=O)Nc1cc(F)cc(F)c1)N1CCN(S(=O)(=O)Cc2nc(C)no2)CC1 |
| InChI | InChI=1S/C18H19ClF2N6O4S/c1-11-23-16(31-25-11)10-32(29,30)27-4-2-26(3-5-27)15(9-22)17(19)18(28)24-14-7-12(20)6-13(21)8-14/h6-9,22H,2-5,10H2,1H3,(H,24,28)/b17-15?,22-9+ |
| InChIKey | NSPKUYUQVBNAAZ-YMEOSBPFSA-N |
| XLogP | 1.84 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.90 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|