C31H34N4O2 — CID 145478979
(Z)-2-(2,3-dihydro-1H-inden-2-yloxy)-4-imino-3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-phenylbut-2-enamide (PubChem CID 145478979) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (Z)-2-(2,3-dihydro-1H-inden-2-yloxy)-4-imino-3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-phenylbut-2-enamide.
| Compound Name | (Z)-2-(2,3-dihydro-1H-inden-2-yloxy)-4-imino-3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-phenylbut-2-enamide |
|---|---|
| PubChem CID | 145478979 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (Z)-2-(2,3-dihydro-1H-inden-2-yloxy)-4-imino-3-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-N-phenylbut-2-enamide |
| SMILES | [H]/N=C/C(=C(/OC1Cc2ccccc2C1)C(=O)Nc1ccccc1)N1CCN(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C31H34N4O2/c1-23-8-7-9-24(18-23)22-34-14-16-35(17-15-34)29(21-32)30(31(36)33-27-12-3-2-4-13-27)37-28-19-25-10-5-6-11-26(25)20-28/h2-13,18,21,28,32H,14-17,19-20,22H2,1H3,(H,33,36)/b30-29-,32-21+ |
| InChIKey | DPCXIZMEYCODHI-XFXPIHNLSA-N |
| XLogP | 4.80 |
| TPSA | 68.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|