C24H28N4O2 — CID 145478271
(Z)-3-imidazolidin-1-yl-4-imino-N-(3-methylphenyl)-2-[(1-phenylcyclopropyl)methoxy]but-2-enamide (PubChem CID 145478271) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (Z)-3-imidazolidin-1-yl-4-imino-N-(3-methylphenyl)-2-[(1-phenylcyclopropyl)methoxy]but-2-enamide.
| Compound Name | (Z)-3-imidazolidin-1-yl-4-imino-N-(3-methylphenyl)-2-[(1-phenylcyclopropyl)methoxy]but-2-enamide |
|---|---|
| PubChem CID | 145478271 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (Z)-3-imidazolidin-1-yl-4-imino-N-(3-methylphenyl)-2-[(1-phenylcyclopropyl)methoxy]but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OCC1(c2ccccc2)CC1)C(=O)Nc1cccc(C)c1)N1CCNC1 |
| InChI | InChI=1S/C24H28N4O2/c1-18-6-5-9-20(14-18)27-23(29)22(21(15-25)28-13-12-26-17-28)30-16-24(10-11-24)19-7-3-2-4-8-19/h2-9,14-15,25-26H,10-13,16-17H2,1H3,(H,27,29)/b22-21-,25-15+ |
| InChIKey | AFKFFQHZCHVCME-ZCMVGKJTSA-N |
| XLogP | 3.41 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|