C20H27ClN4O4S — CID 145478252
4-[(Z)-4-(3-chloroanilino)-3-hex-5-enoxy-1-imino-4-oxobut-2-en-2-yl]piperazine-1-sulfinic acid (PubChem CID 145478252) has the molecular formula C20H27ClN4O4S and a molecular weight of 454.98 g/mol. Its IUPAC name is 4-[(Z)-4-(3-chloroanilino)-3-hex-5-enoxy-1-imino-4-oxobut-2-en-2-yl]piperazine-1-sulfinic acid.
| Compound Name | 4-[(Z)-4-(3-chloroanilino)-3-hex-5-enoxy-1-imino-4-oxobut-2-en-2-yl]piperazine-1-sulfinic acid |
|---|---|
| PubChem CID | 145478252 |
| Molecular Formula | C20H27ClN4O4S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-[(Z)-4-(3-chloroanilino)-3-hex-5-enoxy-1-imino-4-oxobut-2-en-2-yl]piperazine-1-sulfinic acid |
| SMILES | [H]/N=C/C(=C(/OCCCCC=C)C(=O)Nc1cccc(Cl)c1)N1CCN(S(=O)O)CC1 |
| InChI | InChI=1S/C20H27ClN4O4S/c1-2-3-4-5-13-29-19(20(26)23-17-8-6-7-16(21)14-17)18(15-22)24-9-11-25(12-10-24)30(27)28/h2,6-8,14-15,22H,1,3-5,9-13H2,(H,23,26)(H,27,28)/b19-18-,22-15+ |
| InChIKey | YEHQOYHDGZLYCZ-ILHWUOQFSA-N |
| XLogP | 3.27 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|