C20H27ClN4O2 — CID 145478438
(Z)-N-(3-chlorophenyl)-4-imino-2-[(1-methylcyclobutyl)methoxy]-3-piperazin-1-ylbut-2-enamide (PubChem CID 145478438) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-4-imino-2-[(1-methylcyclobutyl)methoxy]-3-piperazin-1-ylbut-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-4-imino-2-[(1-methylcyclobutyl)methoxy]-3-piperazin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 145478438 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-4-imino-2-[(1-methylcyclobutyl)methoxy]-3-piperazin-1-ylbut-2-enamide |
| SMILES | [H]/N=C/C(=C(/OCC1(C)CCC1)C(=O)Nc1cccc(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C20H27ClN4O2/c1-20(6-3-7-20)14-27-18(17(13-22)25-10-8-23-9-11-25)19(26)24-16-5-2-4-15(21)12-16/h2,4-5,12-13,22-23H,3,6-11,14H2,1H3,(H,24,26)/b18-17-,22-13+ |
| InChIKey | NINVQECGQQBMFH-CAXSRKCJSA-N |
| XLogP | 3.25 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|