C23H28ClN5O4S — CID 163798600
(Z)-2-butoxy-N-(3-chlorophenyl)-4-imino-3-[3-(pyridin-4-ylmethylsulfonyl)imidazolidin-1-yl]but-2-enamide (PubChem CID 163798600) has the molecular formula C23H28ClN5O4S and a molecular weight of 506.03 g/mol. Its IUPAC name is (Z)-2-butoxy-N-(3-chlorophenyl)-4-imino-3-[3-(pyridin-4-ylmethylsulfonyl)imidazolidin-1-yl]but-2-enamide.
| Compound Name | (Z)-2-butoxy-N-(3-chlorophenyl)-4-imino-3-[3-(pyridin-4-ylmethylsulfonyl)imidazolidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 163798600 |
| Molecular Formula | C23H28ClN5O4S |
| Molecular Weight | 506.03 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | (Z)-2-butoxy-N-(3-chlorophenyl)-4-imino-3-[3-(pyridin-4-ylmethylsulfonyl)imidazolidin-1-yl]but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OCCCC)C(=O)Nc1cccc(Cl)c1)N1CCN(S(=O)(=O)Cc2ccncc2)C1 |
| InChI | InChI=1S/C23H28ClN5O4S/c1-2-3-13-33-22(23(30)27-20-6-4-5-19(24)14-20)21(15-25)28-11-12-29(17-28)34(31,32)16-18-7-9-26-10-8-18/h4-10,14-15,25H,2-3,11-13,16-17H2,1H3,(H,27,30)/b22-21-,25-15+ |
| InChIKey | NCZCTOYDJMQSTN-ZCMVGKJTSA-N |
| XLogP | 3.46 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.03 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|