C28H28FN5O3 — CID 142829916
4-[(Z)-3-[4-(4-fluorophenyl)phenoxy]-1-imino-4-(4-methylanilino)-4-oxobut-2-en-2-yl]piperazine-1-carboxamide (PubChem CID 142829916) has the molecular formula C28H28FN5O3 and a molecular weight of 501.56 g/mol. Its IUPAC name is 4-[(Z)-3-[4-(4-fluorophenyl)phenoxy]-1-imino-4-(4-methylanilino)-4-oxobut-2-en-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-[(Z)-3-[4-(4-fluorophenyl)phenoxy]-1-imino-4-(4-methylanilino)-4-oxobut-2-en-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 142829916 |
| Molecular Formula | C28H28FN5O3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 4-[(Z)-3-[4-(4-fluorophenyl)phenoxy]-1-imino-4-(4-methylanilino)-4-oxobut-2-en-2-yl]piperazine-1-carboxamide |
| SMILES | [H]/N=C/C(=C(/Oc1ccc(-c2ccc(F)cc2)cc1)C(=O)Nc1ccc(C)cc1)N1CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C28H28FN5O3/c1-19-2-10-23(11-3-19)32-27(35)26(25(18-30)33-14-16-34(17-15-33)28(31)36)37-24-12-6-21(7-13-24)20-4-8-22(29)9-5-20/h2-13,18,30H,14-17H2,1H3,(H2,31,36)(H,32,35)/b26-25-,30-18+ |
| InChIKey | BTFXXXINQBTZGS-MNQFMEMUSA-N |
| XLogP | 4.38 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|