C32H32ClFN4O5 — CID 142829810
(Z)-N-(4-chlorophenyl)-3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-[4-[4-fluoro-2-(methoxymethoxy)phenyl]phenoxy]-4-iminobut-2-enamide (PubChem CID 142829810) has the molecular formula C32H32ClFN4O5 and a molecular weight of 607.08 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-[4-[4-fluoro-2-(methoxymethoxy)phenyl]phenoxy]-4-iminobut-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-[4-[4-fluoro-2-(methoxymethoxy)phenyl]phenoxy]-4-iminobut-2-enamide |
|---|---|
| PubChem CID | 142829810 |
| Molecular Formula | C32H32ClFN4O5 |
| Molecular Weight | 607.08 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-2-[4-[4-fluoro-2-(methoxymethoxy)phenyl]phenoxy]-4-iminobut-2-enamide |
| SMILES | [H]/N=C/C(=C(/Oc1ccc(-c2ccc(F)cc2OCOC)cc1)C(=O)Nc1ccc(Cl)cc1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C32H32ClFN4O5/c1-41-20-42-29-18-24(34)8-13-27(29)21-4-11-26(12-5-21)43-30(31(39)36-25-9-6-23(33)7-10-25)28(19-35)37-14-16-38(17-15-37)32(40)22-2-3-22/h4-13,18-19,22,35H,2-3,14-17,20H2,1H3,(H,36,39)/b30-28-,35-19+ |
| InChIKey | OULLJLIBIHIODY-OAWJFPKQSA-N |
| XLogP | 5.56 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.08 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|