C26H24ClN3O4 — CID 142829790
(Z)-N-(4-chlorophenyl)-2-[4-(4-hydroxyphenyl)phenoxy]-4-imino-3-morpholin-4-ylbut-2-enamide (PubChem CID 142829790) has the molecular formula C26H24ClN3O4 and a molecular weight of 477.95 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-2-[4-(4-hydroxyphenyl)phenoxy]-4-imino-3-morpholin-4-ylbut-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-2-[4-(4-hydroxyphenyl)phenoxy]-4-imino-3-morpholin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 142829790 |
| Molecular Formula | C26H24ClN3O4 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-2-[4-(4-hydroxyphenyl)phenoxy]-4-imino-3-morpholin-4-ylbut-2-enamide |
| SMILES | [H]/N=C/C(=C(/Oc1ccc(-c2ccc(O)cc2)cc1)C(=O)Nc1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C26H24ClN3O4/c27-20-5-7-21(8-6-20)29-26(32)25(24(17-28)30-13-15-33-16-14-30)34-23-11-3-19(4-12-23)18-1-9-22(31)10-2-18/h1-12,17,28,31H,13-16H2,(H,29,32)/b25-24-,28-17+ |
| InChIKey | LWDFCTJZHGBSFL-JCJYIAACSA-N |
| XLogP | 4.92 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|