C16H20ClN3O4 — CID 135426610
(Z)-N-(4-chlorophenyl)-3-ethoxy-3-hydroxy-2-(morpholine-4-carboximidoyl)prop-2-enamide (PubChem CID 135426610) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-3-ethoxy-3-hydroxy-2-(morpholine-4-carboximidoyl)prop-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-3-ethoxy-3-hydroxy-2-(morpholine-4-carboximidoyl)prop-2-enamide |
|---|---|
| PubChem CID | 135426610 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-3-ethoxy-3-hydroxy-2-(morpholine-4-carboximidoyl)prop-2-enamide |
| SMILES | [H]/N=C(C(/C(=O)Nc1ccc(Cl)cc1)=C(\O)OCC)\N1CCOCC1 |
| InChI | InChI=1S/C16H20ClN3O4/c1-2-24-16(22)13(14(18)20-7-9-23-10-8-20)15(21)19-12-5-3-11(17)4-6-12/h3-6,18,22H,2,7-10H2,1H3,(H,19,21)/b16-13-,18-14- |
| InChIKey | WUZJJJUTVMOOHN-DIHSMVEZSA-N |
| XLogP | 2.39 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|