C31H33ClN4O5 — CID 142829833
tert-butyl 4-[(Z)-4-(4-chloroanilino)-3-[4-(4-hydroxyphenyl)phenoxy]-1-imino-4-oxobut-2-en-2-yl]piperazine-1-carboxylate (PubChem CID 142829833) has the molecular formula C31H33ClN4O5 and a molecular weight of 577.08 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-4-(4-chloroanilino)-3-[4-(4-hydroxyphenyl)phenoxy]-1-imino-4-oxobut-2-en-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-4-(4-chloroanilino)-3-[4-(4-hydroxyphenyl)phenoxy]-1-imino-4-oxobut-2-en-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142829833 |
| Molecular Formula | C31H33ClN4O5 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | tert-butyl 4-[(Z)-4-(4-chloroanilino)-3-[4-(4-hydroxyphenyl)phenoxy]-1-imino-4-oxobut-2-en-2-yl]piperazine-1-carboxylate |
| SMILES | [H]/N=C/C(=C(/Oc1ccc(-c2ccc(O)cc2)cc1)C(=O)Nc1ccc(Cl)cc1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H33ClN4O5/c1-31(2,3)41-30(39)36-18-16-35(17-19-36)27(20-33)28(29(38)34-24-10-8-23(32)9-11-24)40-26-14-6-22(7-15-26)21-4-12-25(37)13-5-21/h4-15,20,33,37H,16-19H2,1-3H3,(H,34,38)/b28-27-,33-20+ |
| InChIKey | ZZYLTRRMDKFFDR-CQEZMUKXSA-N |
| XLogP | 6.14 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|