C19H24ClN9O4 — CID 167865195
tert-butyl 4-[5-[[2-[2-(5-chloropyrimidin-2-yl)hydrazinyl]-2-oxoacetyl]amino]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 167865195) has the molecular formula C19H24ClN9O4 and a molecular weight of 477.91 g/mol. Its IUPAC name is tert-butyl 4-[5-[[2-[2-(5-chloropyrimidin-2-yl)hydrazinyl]-2-oxoacetyl]amino]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[[2-[2-(5-chloropyrimidin-2-yl)hydrazinyl]-2-oxoacetyl]amino]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167865195 |
| Molecular Formula | C19H24ClN9O4 |
| Molecular Weight | 477.91 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | tert-butyl 4-[5-[[2-[2-(5-chloropyrimidin-2-yl)hydrazinyl]-2-oxoacetyl]amino]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(NC(=O)C(=O)NNc3ncc(Cl)cn3)cn2)CC1 |
| InChI | InChI=1S/C19H24ClN9O4/c1-19(2,3)33-18(32)29-6-4-28(5-7-29)17-23-10-13(11-24-17)25-14(30)15(31)26-27-16-21-8-12(20)9-22-16/h8-11H,4-7H2,1-3H3,(H,25,30)(H,26,31)(H,21,22,27) |
| InChIKey | PZXUMOGYSHLPLC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 154.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.91 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|